C22H44N2O4 — CID 143354020
acetic acid;(2S)-1-acetyl-N-(3-methyldecan-2-yl)pyrrolidine-2-carboxamide;ethane (PubChem CID 143354020) has the molecular formula C22H44N2O4 and a molecular weight of 400.60 g/mol. Its IUPAC name is acetic acid;(2S)-1-acetyl-N-(3-methyldecan-2-yl)pyrrolidine-2-carboxamide;ethane.
| Compound Name | acetic acid;(2S)-1-acetyl-N-(3-methyldecan-2-yl)pyrrolidine-2-carboxamide;ethane |
|---|---|
| PubChem CID | 143354020 |
| Molecular Formula | C22H44N2O4 |
| Molecular Weight | 400.60 g/mol |
| Exact Mass | 400.33 |
| IUPAC Name | acetic acid;(2S)-1-acetyl-N-(3-methyldecan-2-yl)pyrrolidine-2-carboxamide;ethane |
| SMILES | CC.CC(=O)O.CCCCCCCC(C)C(C)NC(=O)[C@@H]1CCCN1C(C)=O |
| InChI | InChI=1S/C18H34N2O2.C2H4O2.C2H6/c1-5-6-7-8-9-11-14(2)15(3)19-18(22)17-12-10-13-20(17)16(4)21;1-2(3)4;1-2/h14-15,17H,5-13H2,1-4H3,(H,19,22);1H3,(H,3,4);1-2H3/t14?,15?,17-;;/m0../s1 |
| InChIKey | GZGPTBKLCAVWEG-TUYRCQCWSA-N |
| XLogP | 4.62 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.60 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|