C18H28N2O2S — CID 96563528
(2S)-N-[(2R)-octan-2-yl]-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxamide (PubChem CID 96563528) has the molecular formula C18H28N2O2S and a molecular weight of 336.50 g/mol. Its IUPAC name is (2S)-N-[(2R)-octan-2-yl]-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[(2R)-octan-2-yl]-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 96563528 |
| Molecular Formula | C18H28N2O2S |
| Molecular Weight | 336.50 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | (2S)-N-[(2R)-octan-2-yl]-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxamide |
| SMILES | CCCCCC[C@@H](C)NC(=O)[C@@H]1CCCN1C(=O)c1cccs1 |
| InChI | InChI=1S/C18H28N2O2S/c1-3-4-5-6-9-14(2)19-17(21)15-10-7-12-20(15)18(22)16-11-8-13-23-16/h8,11,13-15H,3-7,9-10,12H2,1-2H3,(H,19,21)/t14-,15+/m1/s1 |
| InChIKey | PQULOJOICUKPPA-CABCVRRESA-N |
| XLogP | 3.83 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.50 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|