C16H25N3O2S — CID 119668412
N-(1-aminohexan-2-yl)-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxamide (PubChem CID 119668412) has the molecular formula C16H25N3O2S and a molecular weight of 323.46 g/mol. Its IUPAC name is N-(1-aminohexan-2-yl)-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxamide.
| Compound Name | N-(1-aminohexan-2-yl)-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 119668412 |
| Molecular Formula | C16H25N3O2S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | N-(1-aminohexan-2-yl)-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxamide |
| SMILES | CCCCC(CN)NC(=O)C1CCCN1C(=O)c1cccs1 |
| InChI | InChI=1S/C16H25N3O2S/c1-2-3-6-12(11-17)18-15(20)13-7-4-9-19(13)16(21)14-8-5-10-22-14/h5,8,10,12-13H,2-4,6-7,9,11,17H2,1H3,(H,18,20) |
| InChIKey | CJEZLSHQFZWVFG-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |