C20H40N2O3 — CID 156846202
ethane;5-methylhexan-2-one;(2S)-N-methyl-1-pentanoylpyrrolidine-2-carboxamide (PubChem CID 156846202) has the molecular formula C20H40N2O3 and a molecular weight of 356.55 g/mol. Its IUPAC name is ethane;5-methylhexan-2-one;(2S)-N-methyl-1-pentanoylpyrrolidine-2-carboxamide.
| Compound Name | ethane;5-methylhexan-2-one;(2S)-N-methyl-1-pentanoylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 156846202 |
| Molecular Formula | C20H40N2O3 |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.30 |
| IUPAC Name | ethane;5-methylhexan-2-one;(2S)-N-methyl-1-pentanoylpyrrolidine-2-carboxamide |
| SMILES | CC.CC(=O)CCC(C)C.CCCCC(=O)N1CCC[C@H]1C(=O)NC |
| InChI | InChI=1S/C11H20N2O2.C7H14O.C2H6/c1-3-4-7-10(14)13-8-5-6-9(13)11(15)12-2;1-6(2)4-5-7(3)8;1-2/h9H,3-8H2,1-2H3,(H,12,15);6H,4-5H2,1-3H3;1-2H3/t9-;;/m0../s1 |
| InChIKey | PUBYISFFIGMBEL-WWPIYYJJSA-N |
| XLogP | 3.95 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |