C11H19ClN2O2 — CID 60949379
1-(5-chloropentanoyl)-N-methylpyrrolidine-2-carboxamide (PubChem CID 60949379) has the molecular formula C11H19ClN2O2 and a molecular weight of 246.74 g/mol. Its IUPAC name is 1-(5-chloropentanoyl)-N-methylpyrrolidine-2-carboxamide.
| Compound Name | 1-(5-chloropentanoyl)-N-methylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 60949379 |
| Molecular Formula | C11H19ClN2O2 |
| Molecular Weight | 246.74 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 1-(5-chloropentanoyl)-N-methylpyrrolidine-2-carboxamide |
| SMILES | CNC(=O)C1CCCN1C(=O)CCCCCl |
| InChI | InChI=1S/C11H19ClN2O2/c1-13-11(16)9-5-4-8-14(9)10(15)6-2-3-7-12/h9H,2-8H2,1H3,(H,13,16) |
| InChIKey | GXCLGAOUKQEDSI-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.74 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|