C13H18N2O3 — CID 143360223
1-formyl-N-(2-oxohept-6-yn-3-yl)pyrrolidine-2-carboxamide (PubChem CID 143360223) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is 1-formyl-N-(2-oxohept-6-yn-3-yl)pyrrolidine-2-carboxamide.
| Compound Name | 1-formyl-N-(2-oxohept-6-yn-3-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 143360223 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 1-formyl-N-(2-oxohept-6-yn-3-yl)pyrrolidine-2-carboxamide |
| SMILES | C#CCCC(NC(=O)C1CCCN1C=O)C(C)=O |
| InChI | InChI=1S/C13H18N2O3/c1-3-4-6-11(10(2)17)14-13(18)12-7-5-8-15(12)9-16/h1,9,11-12H,4-8H2,2H3,(H,14,18) |
| InChIKey | JEKZUSGACWANLB-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|