C28H49N5O5 — CID 143354931
butane;1-[3,3-dimethyl-2-(methylcarbamoylamino)butanoyl]-N-(2-oxohept-6-yn-3-yl)pyrrolidine-2-carboxamide;N-prop-2-enylformamide (PubChem CID 143354931) has the molecular formula C28H49N5O5 and a molecular weight of 535.73 g/mol. Its IUPAC name is butane;1-[3,3-dimethyl-2-(methylcarbamoylamino)butanoyl]-N-(2-oxohept-6-yn-3-yl)pyrrolidine-2-carboxamide;N-prop-2-enylformamide.
| Compound Name | butane;1-[3,3-dimethyl-2-(methylcarbamoylamino)butanoyl]-N-(2-oxohept-6-yn-3-yl)pyrrolidine-2-carboxamide;N-prop-2-enylformamide |
|---|---|
| PubChem CID | 143354931 |
| Molecular Formula | C28H49N5O5 |
| Molecular Weight | 535.73 g/mol |
| Exact Mass | 535.37 |
| IUPAC Name | butane;1-[3,3-dimethyl-2-(methylcarbamoylamino)butanoyl]-N-(2-oxohept-6-yn-3-yl)pyrrolidine-2-carboxamide;N-prop-2-enylformamide |
| SMILES | C#CCCC(NC(=O)C1CCCN1C(=O)C(NC(=O)NC)C(C)(C)C)C(C)=O.C=CCNC=O.CCCC |
| InChI | InChI=1S/C20H32N4O4.C4H7NO.C4H10/c1-7-8-10-14(13(2)25)22-17(26)15-11-9-12-24(15)18(27)16(20(3,4)5)23-19(28)21-6;1-2-3-5-4-6;1-3-4-2/h1,14-16H,8-12H2,2-6H3,(H,22,26)(H2,21,23,28);2,4H,1,3H2,(H,5,6);3-4H2,1-2H3 |
| InChIKey | JQYFYRAIVBVIOF-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 136.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.73 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|