C30H47N5O6S — CID 143105906
(2S)-1-[3,3-dimethyl-2-(1-methylsulfinylpentan-2-ylcarbamoylamino)butanoyl]-N-[1,2-dioxo-1-(pent-4-ynylamino)hept-6-yn-3-yl]pyrrolidine-2-carboxamide (PubChem CID 143105906) has the molecular formula C30H47N5O6S and a molecular weight of 605.80 g/mol. Its IUPAC name is (2S)-1-[3,3-dimethyl-2-(1-methylsulfinylpentan-2-ylcarbamoylamino)butanoyl]-N-[1,2-dioxo-1-(pent-4-ynylamino)hept-6-yn-3-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[3,3-dimethyl-2-(1-methylsulfinylpentan-2-ylcarbamoylamino)butanoyl]-N-[1,2-dioxo-1-(pent-4-ynylamino)hept-6-yn-3-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 143105906 |
| Molecular Formula | C30H47N5O6S |
| Molecular Weight | 605.80 g/mol |
| Exact Mass | 605.32 |
| IUPAC Name | (2S)-1-[3,3-dimethyl-2-(1-methylsulfinylpentan-2-ylcarbamoylamino)butanoyl]-N-[1,2-dioxo-1-(pent-4-ynylamino)hept-6-yn-3-yl]pyrrolidine-2-carboxamide |
| SMILES | C#CCCCNC(=O)C(=O)C(CCC#C)NC(=O)[C@@H]1CCCN1C(=O)C(NC(=O)NC(CCC)CS(C)=O)C(C)(C)C |
| InChI | InChI=1S/C30H47N5O6S/c1-8-11-13-18-31-27(38)24(36)22(16-12-9-2)33-26(37)23-17-14-19-35(23)28(39)25(30(4,5)6)34-29(40)32-21(15-10-3)20-42(7)41/h1-2,21-23,25H,10-20H2,3-7H3,(H,31,38)(H,33,37)(H2,32,34,40)/t21?,22?,23-,25?,42?/m0/s1 |
| InChIKey | RPKDFZHBXVZAIB-QOPXXLAASA-N |
| XLogP | 1.24 |
| TPSA | 153.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.80 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|