C34H54N4O5 — CID 143355220
(2S)-1-[3,3-dimethyl-2-(1-phenylnonan-2-ylcarbamoylamino)butanoyl]-N-(2,3-dioxoheptan-4-yl)pyrrolidine-2-carboxamide (PubChem CID 143355220) has the molecular formula C34H54N4O5 and a molecular weight of 598.83 g/mol. Its IUPAC name is (2S)-1-[3,3-dimethyl-2-(1-phenylnonan-2-ylcarbamoylamino)butanoyl]-N-(2,3-dioxoheptan-4-yl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[3,3-dimethyl-2-(1-phenylnonan-2-ylcarbamoylamino)butanoyl]-N-(2,3-dioxoheptan-4-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 143355220 |
| Molecular Formula | C34H54N4O5 |
| Molecular Weight | 598.83 g/mol |
| Exact Mass | 598.41 |
| IUPAC Name | (2S)-1-[3,3-dimethyl-2-(1-phenylnonan-2-ylcarbamoylamino)butanoyl]-N-(2,3-dioxoheptan-4-yl)pyrrolidine-2-carboxamide |
| SMILES | CCCCCCCC(Cc1ccccc1)NC(=O)NC(C(=O)N1CCC[C@H]1C(=O)NC(CCC)C(=O)C(C)=O)C(C)(C)C |
| InChI | InChI=1S/C34H54N4O5/c1-7-9-10-11-15-20-26(23-25-18-13-12-14-19-25)35-33(43)37-30(34(4,5)6)32(42)38-22-16-21-28(38)31(41)36-27(17-8-2)29(40)24(3)39/h12-14,18-19,26-28,30H,7-11,15-17,20-23H2,1-6H3,(H,36,41)(H2,35,37,43)/t26?,27?,28-,30?/m0/s1 |
| InChIKey | SQSJJYAKUXCTMW-YVWUVWRGSA-N |
| XLogP | 5.11 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.83 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|