C42H69N5O6 — CID 143357487
1-[3,3-dimethyl-1-(2-methylpyrrolidin-1-yl)-1-oxobutan-2-yl]-3-[1-(3-methoxyphenyl)octan-2-yl]urea;3-formamido-2-oxo-N-prop-2-enylhept-6-ynamide;2-methylpropane (PubChem CID 143357487) has the molecular formula C42H69N5O6 and a molecular weight of 740.04 g/mol. Its IUPAC name is 1-[3,3-dimethyl-1-(2-methylpyrrolidin-1-yl)-1-oxobutan-2-yl]-3-[1-(3-methoxyphenyl)octan-2-yl]urea;3-formamido-2-oxo-N-prop-2-enylhept-6-ynamide;2-methylpropane.
| Compound Name | 1-[3,3-dimethyl-1-(2-methylpyrrolidin-1-yl)-1-oxobutan-2-yl]-3-[1-(3-methoxyphenyl)octan-2-yl]urea;3-formamido-2-oxo-N-prop-2-enylhept-6-ynamide;2-methylpropane |
|---|---|
| PubChem CID | 143357487 |
| Molecular Formula | C42H69N5O6 |
| Molecular Weight | 740.04 g/mol |
| Exact Mass | 739.52 |
| IUPAC Name | 1-[3,3-dimethyl-1-(2-methylpyrrolidin-1-yl)-1-oxobutan-2-yl]-3-[1-(3-methoxyphenyl)octan-2-yl]urea;3-formamido-2-oxo-N-prop-2-enylhept-6-ynamide;2-methylpropane |
| SMILES | C#CCCC(NC=O)C(=O)C(=O)NCC=C.CC(C)C.CCCCCCC(Cc1cccc(OC)c1)NC(=O)NC(C(=O)N1CCCC1C)C(C)(C)C |
| InChI | InChI=1S/C27H45N3O3.C11H14N2O3.C4H10/c1-7-8-9-10-15-22(18-21-14-11-16-23(19-21)33-6)28-26(32)29-24(27(3,4)5)25(31)30-17-12-13-20(30)2;1-3-5-6-9(13-8-14)10(15)11(16)12-7-4-2;1-4(2)3/h11,14,16,19-20,22,24H,7-10,12-13,15,17-18H2,1-6H3,(H2,28,29,32);1,4,8-9H,2,5-7H2,(H,12,16)(H,13,14);4H,1-3H3 |
| InChIKey | VHLXYUJAXJOCLH-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 145.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.04 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|