C22H39N5O5 — CID 143361213
(2S)-1-[(2S)-2-[[amino(hydroxy)methyl]amino]-3,3-dimethylbutanoyl]-N-[1,2-dioxo-1-(prop-2-enylamino)heptan-3-yl]pyrrolidine-2-carboxamide (PubChem CID 143361213) has the molecular formula C22H39N5O5 and a molecular weight of 453.58 g/mol. Its IUPAC name is (2S)-1-[(2S)-2-[[amino(hydroxy)methyl]amino]-3,3-dimethylbutanoyl]-N-[1,2-dioxo-1-(prop-2-enylamino)heptan-3-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(2S)-2-[[amino(hydroxy)methyl]amino]-3,3-dimethylbutanoyl]-N-[1,2-dioxo-1-(prop-2-enylamino)heptan-3-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 143361213 |
| Molecular Formula | C22H39N5O5 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.30 |
| IUPAC Name | (2S)-1-[(2S)-2-[[amino(hydroxy)methyl]amino]-3,3-dimethylbutanoyl]-N-[1,2-dioxo-1-(prop-2-enylamino)heptan-3-yl]pyrrolidine-2-carboxamide |
| SMILES | C=CCNC(=O)C(=O)C(CCCC)NC(=O)[C@@H]1CCCN1C(=O)[C@@H](NC(N)O)C(C)(C)C |
| InChI | InChI=1S/C22H39N5O5/c1-6-8-10-14(16(28)19(30)24-12-7-2)25-18(29)15-11-9-13-27(15)20(31)17(22(3,4)5)26-21(23)32/h7,14-15,17,21,26,32H,2,6,8-13,23H2,1,3-5H3,(H,24,30)(H,25,29)/t14?,15-,17+,21?/m0/s1 |
| InChIKey | XXCQLSIODZJHAC-HQNGXFHWSA-N |
| XLogP | -0.24 |
| TPSA | 153.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|