C20H34N4O4 — CID 70322014
(2S)-1-[(2S)-2-amino-3,3-dimethylbutanoyl]-N-[3-methyl-1,2-dioxo-1-(prop-2-enylamino)pentan-3-yl]pyrrolidine-2-carboxamide (PubChem CID 70322014) has the molecular formula C20H34N4O4 and a molecular weight of 394.52 g/mol. Its IUPAC name is (2S)-1-[(2S)-2-amino-3,3-dimethylbutanoyl]-N-[3-methyl-1,2-dioxo-1-(prop-2-enylamino)pentan-3-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(2S)-2-amino-3,3-dimethylbutanoyl]-N-[3-methyl-1,2-dioxo-1-(prop-2-enylamino)pentan-3-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 70322014 |
| Molecular Formula | C20H34N4O4 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.26 |
| IUPAC Name | (2S)-1-[(2S)-2-amino-3,3-dimethylbutanoyl]-N-[3-methyl-1,2-dioxo-1-(prop-2-enylamino)pentan-3-yl]pyrrolidine-2-carboxamide |
| SMILES | C=CCNC(=O)C(=O)C(C)(CC)NC(=O)[C@@H]1CCCN1C(=O)[C@@H](N)C(C)(C)C |
| InChI | InChI=1S/C20H34N4O4/c1-7-11-22-17(27)15(25)20(6,8-2)23-16(26)13-10-9-12-24(13)18(28)14(21)19(3,4)5/h7,13-14H,1,8-12,21H2,2-6H3,(H,22,27)(H,23,26)/t13-,14+,20?/m0/s1 |
| InChIKey | JMTGWMFXIKBJCG-IODPJOFQSA-N |
| XLogP | 0.51 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|