C12H23N2O3P — CID 70822851
phosphanylmethyl 1-(2-amino-3,3-dimethylbutanoyl)pyrrolidine-2-carboxylate (PubChem CID 70822851) has the molecular formula C12H23N2O3P and a molecular weight of 274.30 g/mol. Its IUPAC name is phosphanylmethyl 1-(2-amino-3,3-dimethylbutanoyl)pyrrolidine-2-carboxylate.
| Compound Name | phosphanylmethyl 1-(2-amino-3,3-dimethylbutanoyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 70822851 |
| Molecular Formula | C12H23N2O3P |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | phosphanylmethyl 1-(2-amino-3,3-dimethylbutanoyl)pyrrolidine-2-carboxylate |
| SMILES | CC(C)(C)C(N)C(=O)N1CCCC1C(=O)OCP |
| InChI | InChI=1S/C12H23N2O3P/c1-12(2,3)9(13)10(15)14-6-4-5-8(14)11(16)17-7-18/h8-9H,4-7,13,18H2,1-3H3 |
| InChIKey | UBIHJJOCAPANRH-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|