C12H23N3O2 — CID 76894481
1-(2-amino-3,3-dimethylbutanoyl)piperidine-2-carboxamide (PubChem CID 76894481) has the molecular formula C12H23N3O2 and a molecular weight of 241.33 g/mol. Its IUPAC name is 1-(2-amino-3,3-dimethylbutanoyl)piperidine-2-carboxamide.
| Compound Name | 1-(2-amino-3,3-dimethylbutanoyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 76894481 |
| Molecular Formula | C12H23N3O2 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | 1-(2-amino-3,3-dimethylbutanoyl)piperidine-2-carboxamide |
| SMILES | CC(C)(C)C(N)C(=O)N1CCCCC1C(N)=O |
| InChI | InChI=1S/C12H23N3O2/c1-12(2,3)9(13)11(17)15-7-5-4-6-8(15)10(14)16/h8-9H,4-7,13H2,1-3H3,(H2,14,16) |
| InChIKey | QNMDRSQVSKZVQP-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |