C22H33N3O3 — CID 170584258
1-(2-amino-3,3-dimethylbutanoyl)pyrrolidine-2-carboxamide;1-ethynyl-4-(2-methoxyethyl)benzene (PubChem CID 170584258) has the molecular formula C22H33N3O3 and a molecular weight of 387.52 g/mol. Its IUPAC name is 1-(2-amino-3,3-dimethylbutanoyl)pyrrolidine-2-carboxamide;1-ethynyl-4-(2-methoxyethyl)benzene.
| Compound Name | 1-(2-amino-3,3-dimethylbutanoyl)pyrrolidine-2-carboxamide;1-ethynyl-4-(2-methoxyethyl)benzene |
|---|---|
| PubChem CID | 170584258 |
| Molecular Formula | C22H33N3O3 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.25 |
| IUPAC Name | 1-(2-amino-3,3-dimethylbutanoyl)pyrrolidine-2-carboxamide;1-ethynyl-4-(2-methoxyethyl)benzene |
| SMILES | C#Cc1ccc(CCOC)cc1.CC(C)(C)C(N)C(=O)N1CCCC1C(N)=O |
| InChI | InChI=1S/C11H21N3O2.C11H12O/c1-11(2,3)8(12)10(16)14-6-4-5-7(14)9(13)15;1-3-10-4-6-11(7-5-10)8-9-12-2/h7-8H,4-6,12H2,1-3H3,(H2,13,15);1,4-7H,8-9H2,2H3 |
| InChIKey | DBOQAKJILZZZJH-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 98.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|