C21H29N3O2 — CID 170613098
1-(2-amino-3,3-dimethylbutanoyl)-N-[(4-prop-1-ynylphenyl)methyl]pyrrolidine-2-carboxamide (PubChem CID 170613098) has the molecular formula C21H29N3O2 and a molecular weight of 355.48 g/mol. Its IUPAC name is 1-(2-amino-3,3-dimethylbutanoyl)-N-[(4-prop-1-ynylphenyl)methyl]pyrrolidine-2-carboxamide.
| Compound Name | 1-(2-amino-3,3-dimethylbutanoyl)-N-[(4-prop-1-ynylphenyl)methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 170613098 |
| Molecular Formula | C21H29N3O2 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | 1-(2-amino-3,3-dimethylbutanoyl)-N-[(4-prop-1-ynylphenyl)methyl]pyrrolidine-2-carboxamide |
| SMILES | CC#Cc1ccc(CNC(=O)C2CCCN2C(=O)C(N)C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H29N3O2/c1-5-7-15-9-11-16(12-10-15)14-23-19(25)17-8-6-13-24(17)20(26)18(22)21(2,3)4/h9-12,17-18H,6,8,13-14,22H2,1-4H3,(H,23,25) |
| InChIKey | XMZHTIYHENYKJN-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|