C22H23N3O3 — CID 22476149
N-[(4-cyanophenyl)methyl]-1-(2-hydroxy-3-phenylpropanoyl)pyrrolidine-2-carboxamide (PubChem CID 22476149) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is N-[(4-cyanophenyl)methyl]-1-(2-hydroxy-3-phenylpropanoyl)pyrrolidine-2-carboxamide.
| Compound Name | N-[(4-cyanophenyl)methyl]-1-(2-hydroxy-3-phenylpropanoyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 22476149 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | N-[(4-cyanophenyl)methyl]-1-(2-hydroxy-3-phenylpropanoyl)pyrrolidine-2-carboxamide |
| SMILES | N#Cc1ccc(CNC(=O)C2CCCN2C(=O)C(O)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C22H23N3O3/c23-14-17-8-10-18(11-9-17)15-24-21(27)19-7-4-12-25(19)22(28)20(26)13-16-5-2-1-3-6-16/h1-3,5-6,8-11,19-20,26H,4,7,12-13,15H2,(H,24,27) |
| InChIKey | KNLVYDUDNZEUJX-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |