C22H28ClN5O2 — CID 174455746
(2S)-1-(2-amino-3-phenylpropanoyl)-N-[(4-methanehydrazonoylphenyl)methyl]pyrrolidine-2-carboxamide;hydrochloride (PubChem CID 174455746) has the molecular formula C22H28ClN5O2 and a molecular weight of 429.95 g/mol. Its IUPAC name is (2S)-1-(2-amino-3-phenylpropanoyl)-N-[(4-methanehydrazonoylphenyl)methyl]pyrrolidine-2-carboxamide;hydrochloride.
| Compound Name | (2S)-1-(2-amino-3-phenylpropanoyl)-N-[(4-methanehydrazonoylphenyl)methyl]pyrrolidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 174455746 |
| Molecular Formula | C22H28ClN5O2 |
| Molecular Weight | 429.95 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | (2S)-1-(2-amino-3-phenylpropanoyl)-N-[(4-methanehydrazonoylphenyl)methyl]pyrrolidine-2-carboxamide;hydrochloride |
| SMILES | Cl.NN=Cc1ccc(CNC(=O)[C@@H]2CCCN2C(=O)C(N)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C22H27N5O2.ClH/c23-19(13-16-5-2-1-3-6-16)22(29)27-12-4-7-20(27)21(28)25-14-17-8-10-18(11-9-17)15-26-24;/h1-3,5-6,8-11,15,19-20H,4,7,12-14,23-24H2,(H,25,28);1H/t19?,20-;/m0./s1 |
| InChIKey | TZVGKXBTOUPHGQ-XSAAWUBDSA-N |
| XLogP | 1.58 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.95 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|