C23H33N3O3 — CID 167284606
1-(2-amino-5-ethoxy-3,3-dimethylpentanoyl)-N-[(4-ethynylphenyl)methyl]pyrrolidine-2-carboxamide (PubChem CID 167284606) has the molecular formula C23H33N3O3 and a molecular weight of 399.54 g/mol. Its IUPAC name is 1-(2-amino-5-ethoxy-3,3-dimethylpentanoyl)-N-[(4-ethynylphenyl)methyl]pyrrolidine-2-carboxamide.
| Compound Name | 1-(2-amino-5-ethoxy-3,3-dimethylpentanoyl)-N-[(4-ethynylphenyl)methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 167284606 |
| Molecular Formula | C23H33N3O3 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.25 |
| IUPAC Name | 1-(2-amino-5-ethoxy-3,3-dimethylpentanoyl)-N-[(4-ethynylphenyl)methyl]pyrrolidine-2-carboxamide |
| SMILES | C#Cc1ccc(CNC(=O)C2CCCN2C(=O)C(N)C(C)(C)CCOCC)cc1 |
| InChI | InChI=1S/C23H33N3O3/c1-5-17-9-11-18(12-10-17)16-25-21(27)19-8-7-14-26(19)22(28)20(24)23(3,4)13-15-29-6-2/h1,9-12,19-20H,6-8,13-16,24H2,2-4H3,(H,25,27) |
| InChIKey | NTLXGNGMXKRXBR-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|