C18H31N3O3 — CID 143358839
(2S)-1-[(2S)-2-amino-3,3-dimethylbutanoyl]-N-(1-cyclobutyl-3-oxopropan-2-yl)pyrrolidine-2-carboxamide (PubChem CID 143358839) has the molecular formula C18H31N3O3 and a molecular weight of 337.46 g/mol. Its IUPAC name is (2S)-1-[(2S)-2-amino-3,3-dimethylbutanoyl]-N-(1-cyclobutyl-3-oxopropan-2-yl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(2S)-2-amino-3,3-dimethylbutanoyl]-N-(1-cyclobutyl-3-oxopropan-2-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 143358839 |
| Molecular Formula | C18H31N3O3 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.24 |
| IUPAC Name | (2S)-1-[(2S)-2-amino-3,3-dimethylbutanoyl]-N-(1-cyclobutyl-3-oxopropan-2-yl)pyrrolidine-2-carboxamide |
| SMILES | CC(C)(C)[C@H](N)C(=O)N1CCC[C@H]1C(=O)NC(C=O)CC1CCC1 |
| InChI | InChI=1S/C18H31N3O3/c1-18(2,3)15(19)17(24)21-9-5-8-14(21)16(23)20-13(11-22)10-12-6-4-7-12/h11-15H,4-10,19H2,1-3H3,(H,20,23)/t13?,14-,15+/m0/s1 |
| InChIKey | UZLXKJVKIBBOMT-NOYMGPGASA-N |
| XLogP | 1.22 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|