C28H47N5O6S — CID 143106058
1-[3,3-dimethyl-2-[1-(1-oxothiolan-2-yl)propylcarbamoylamino]butanoyl]-N-[1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]pyrrolidine-2-carboxamide (PubChem CID 143106058) has the molecular formula C28H47N5O6S and a molecular weight of 581.78 g/mol. Its IUPAC name is 1-[3,3-dimethyl-2-[1-(1-oxothiolan-2-yl)propylcarbamoylamino]butanoyl]-N-[1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]pyrrolidine-2-carboxamide.
| Compound Name | 1-[3,3-dimethyl-2-[1-(1-oxothiolan-2-yl)propylcarbamoylamino]butanoyl]-N-[1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 143106058 |
| Molecular Formula | C28H47N5O6S |
| Molecular Weight | 581.78 g/mol |
| Exact Mass | 581.32 |
| IUPAC Name | 1-[3,3-dimethyl-2-[1-(1-oxothiolan-2-yl)propylcarbamoylamino]butanoyl]-N-[1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]pyrrolidine-2-carboxamide |
| SMILES | C=CCNC(=O)C(=O)C(CCC)NC(=O)C1CCCN1C(=O)C(NC(=O)NC(CC)C1CCCS1=O)C(C)(C)C |
| InChI | InChI=1S/C28H47N5O6S/c1-7-12-19(22(34)25(36)29-15-8-2)30-24(35)20-13-10-16-33(20)26(37)23(28(4,5)6)32-27(38)31-18(9-3)21-14-11-17-40(21)39/h8,18-21,23H,2,7,9-17H2,1,3-6H3,(H,29,36)(H,30,35)(H2,31,32,38) |
| InChIKey | DJKZFFAVKMSKGW-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 153.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.78 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|