C31H53N5O5 — CID 143359684
(3R)-1-[2-cyclohexyl-2-(methylcarbamoylamino)acetyl]-N-(2-oxohept-6-yn-3-yl)-3-propan-2-ylpyrrolidine-2-carboxamide;ethane;N-prop-2-enylformamide (PubChem CID 143359684) has the molecular formula C31H53N5O5 and a molecular weight of 575.80 g/mol. Its IUPAC name is (3R)-1-[2-cyclohexyl-2-(methylcarbamoylamino)acetyl]-N-(2-oxohept-6-yn-3-yl)-3-propan-2-ylpyrrolidine-2-carboxamide;ethane;N-prop-2-enylformamide.
| Compound Name | (3R)-1-[2-cyclohexyl-2-(methylcarbamoylamino)acetyl]-N-(2-oxohept-6-yn-3-yl)-3-propan-2-ylpyrrolidine-2-carboxamide;ethane;N-prop-2-enylformamide |
|---|---|
| PubChem CID | 143359684 |
| Molecular Formula | C31H53N5O5 |
| Molecular Weight | 575.80 g/mol |
| Exact Mass | 575.40 |
| IUPAC Name | (3R)-1-[2-cyclohexyl-2-(methylcarbamoylamino)acetyl]-N-(2-oxohept-6-yn-3-yl)-3-propan-2-ylpyrrolidine-2-carboxamide;ethane;N-prop-2-enylformamide |
| SMILES | C#CCCC(NC(=O)C1[C@@H](C(C)C)CCN1C(=O)C(NC(=O)NC)C1CCCCC1)C(C)=O.C=CCNC=O.CC |
| InChI | InChI=1S/C25H40N4O4.C4H7NO.C2H6/c1-6-7-13-20(17(4)30)27-23(31)22-19(16(2)3)14-15-29(22)24(32)21(28-25(33)26-5)18-11-9-8-10-12-18;1-2-3-5-4-6;1-2/h1,16,18-22H,7-15H2,2-5H3,(H,27,31)(H2,26,28,33);2,4H,1,3H2,(H,5,6);1-2H3/t19-,20?,21?,22?;;/m1../s1 |
| InChIKey | JKDDLKNSUVJBEB-IDXSGUGQSA-N |
| XLogP | 3.17 |
| TPSA | 136.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.80 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|