C20H32N4O5 — CID 143353105
1-[3,3-dimethyl-2-(methylcarbamoylamino)butanoyl]-N-(1,2-dioxohept-6-en-3-yl)pyrrolidine-2-carboxamide (PubChem CID 143353105) has the molecular formula C20H32N4O5 and a molecular weight of 408.50 g/mol. Its IUPAC name is 1-[3,3-dimethyl-2-(methylcarbamoylamino)butanoyl]-N-(1,2-dioxohept-6-en-3-yl)pyrrolidine-2-carboxamide.
| Compound Name | 1-[3,3-dimethyl-2-(methylcarbamoylamino)butanoyl]-N-(1,2-dioxohept-6-en-3-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 143353105 |
| Molecular Formula | C20H32N4O5 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | 1-[3,3-dimethyl-2-(methylcarbamoylamino)butanoyl]-N-(1,2-dioxohept-6-en-3-yl)pyrrolidine-2-carboxamide |
| SMILES | C=CCCC(NC(=O)C1CCCN1C(=O)C(NC(=O)NC)C(C)(C)C)C(=O)C=O |
| InChI | InChI=1S/C20H32N4O5/c1-6-7-9-13(15(26)12-25)22-17(27)14-10-8-11-24(14)18(28)16(20(2,3)4)23-19(29)21-5/h6,12-14,16H,1,7-11H2,2-5H3,(H,22,27)(H2,21,23,29) |
| InChIKey | WZYYADAXAMKNBS-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|