C32H53N5O7S — CID 70331543
(2S)-N-[4-(but-3-enylamino)-1-cyclobutyl-3,4-dioxobutan-2-yl]-1-[(2S)-3,3-dimethyl-2-[[1-(methylsulfonylmethyl)cyclohexyl]carbamoylamino]butanoyl]pyrrolidine-2-carboxamide (PubChem CID 70331543) has the molecular formula C32H53N5O7S and a molecular weight of 651.87 g/mol. Its IUPAC name is (2S)-N-[4-(but-3-enylamino)-1-cyclobutyl-3,4-dioxobutan-2-yl]-1-[(2S)-3,3-dimethyl-2-[[1-(methylsulfonylmethyl)cyclohexyl]carbamoylamino]butanoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[4-(but-3-enylamino)-1-cyclobutyl-3,4-dioxobutan-2-yl]-1-[(2S)-3,3-dimethyl-2-[[1-(methylsulfonylmethyl)cyclohexyl]carbamoylamino]butanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 70331543 |
| Molecular Formula | C32H53N5O7S |
| Molecular Weight | 651.87 g/mol |
| Exact Mass | 651.37 |
| IUPAC Name | (2S)-N-[4-(but-3-enylamino)-1-cyclobutyl-3,4-dioxobutan-2-yl]-1-[(2S)-3,3-dimethyl-2-[[1-(methylsulfonylmethyl)cyclohexyl]carbamoylamino]butanoyl]pyrrolidine-2-carboxamide |
| SMILES | C=CCCNC(=O)C(=O)C(CC1CCC1)NC(=O)[C@@H]1CCCN1C(=O)[C@@H](NC(=O)NC1(CS(C)(=O)=O)CCCCC1)C(C)(C)C |
| InChI | InChI=1S/C32H53N5O7S/c1-6-7-18-33-28(40)25(38)23(20-22-13-11-14-22)34-27(39)24-15-12-19-37(24)29(41)26(31(2,3)4)35-30(42)36-32(21-45(5,43)44)16-9-8-10-17-32/h6,22-24,26H,1,7-21H2,2-5H3,(H,33,40)(H,34,39)(H2,35,36,42)/t23?,24-,26+/m0/s1 |
| InChIKey | LPJWYHOARQLRQY-GKZYAJIGSA-N |
| XLogP | 2.38 |
| TPSA | 170.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.87 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|