C35H61N5O7S — CID 123423448
N-but-3-enyl-3-[[[1-[3,3-dimethyl-2-[[1-(3-methylbutylsulfonylmethyl)cyclohexyl]carbamoylamino]butanoyl]pyrrolidin-2-yl]-hydroxymethyl]amino]-2-oxohept-6-enamide (PubChem CID 123423448) has the molecular formula C35H61N5O7S and a molecular weight of 695.97 g/mol. Its IUPAC name is N-but-3-enyl-3-[[[1-[3,3-dimethyl-2-[[1-(3-methylbutylsulfonylmethyl)cyclohexyl]carbamoylamino]butanoyl]pyrrolidin-2-yl]-hydroxymethyl]amino]-2-oxohept-6-enamide.
| Compound Name | N-but-3-enyl-3-[[[1-[3,3-dimethyl-2-[[1-(3-methylbutylsulfonylmethyl)cyclohexyl]carbamoylamino]butanoyl]pyrrolidin-2-yl]-hydroxymethyl]amino]-2-oxohept-6-enamide |
|---|---|
| PubChem CID | 123423448 |
| Molecular Formula | C35H61N5O7S |
| Molecular Weight | 695.97 g/mol |
| Exact Mass | 695.43 |
| IUPAC Name | N-but-3-enyl-3-[[[1-[3,3-dimethyl-2-[[1-(3-methylbutylsulfonylmethyl)cyclohexyl]carbamoylamino]butanoyl]pyrrolidin-2-yl]-hydroxymethyl]amino]-2-oxohept-6-enamide |
| SMILES | C=CCCNC(=O)C(=O)C(CCC=C)NC(O)C1CCCN1C(=O)C(NC(=O)NC1(CS(=O)(=O)CCC(C)C)CCCCC1)C(C)(C)C |
| InChI | InChI=1S/C35H61N5O7S/c1-8-10-16-26(28(41)31(43)36-21-11-9-2)37-30(42)27-17-15-22-40(27)32(44)29(34(5,6)7)38-33(45)39-35(19-13-12-14-20-35)24-48(46,47)23-18-25(3)4/h8-9,25-27,29-30,37,42H,1-2,10-24H2,3-7H3,(H,36,43)(H2,38,39,45) |
| InChIKey | GQRZSBHPXIURCI-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 174.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.97 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|