C36H65N5O7S — CID 143105849
(2S)-N-[4-(but-3-enylamino)-1-cyclobutyl-3,4-dioxobutan-2-yl]-1-[3,3-dimethyl-2-[[1-(methylsulfonylmethyl)cyclohexyl]carbamoylamino]butanoyl]pyrrolidine-2-carboxamide;ethane (PubChem CID 143105849) has the molecular formula C36H65N5O7S and a molecular weight of 712.01 g/mol. Its IUPAC name is (2S)-N-[4-(but-3-enylamino)-1-cyclobutyl-3,4-dioxobutan-2-yl]-1-[3,3-dimethyl-2-[[1-(methylsulfonylmethyl)cyclohexyl]carbamoylamino]butanoyl]pyrrolidine-2-carboxamide;ethane.
| Compound Name | (2S)-N-[4-(but-3-enylamino)-1-cyclobutyl-3,4-dioxobutan-2-yl]-1-[3,3-dimethyl-2-[[1-(methylsulfonylmethyl)cyclohexyl]carbamoylamino]butanoyl]pyrrolidine-2-carboxamide;ethane |
|---|---|
| PubChem CID | 143105849 |
| Molecular Formula | C36H65N5O7S |
| Molecular Weight | 712.01 g/mol |
| Exact Mass | 711.46 |
| IUPAC Name | (2S)-N-[4-(but-3-enylamino)-1-cyclobutyl-3,4-dioxobutan-2-yl]-1-[3,3-dimethyl-2-[[1-(methylsulfonylmethyl)cyclohexyl]carbamoylamino]butanoyl]pyrrolidine-2-carboxamide;ethane |
| SMILES | C=CCCNC(=O)C(=O)C(CC1CCC1)NC(=O)[C@@H]1CCCN1C(=O)C(NC(=O)NC1(CS(C)(=O)=O)CCCCC1)C(C)(C)C.CC.CC |
| InChI | InChI=1S/C32H53N5O7S.2C2H6/c1-6-7-18-33-28(40)25(38)23(20-22-13-11-14-22)34-27(39)24-15-12-19-37(24)29(41)26(31(2,3)4)35-30(42)36-32(21-45(5,43)44)16-9-8-10-17-32;2*1-2/h6,22-24,26H,1,7-21H2,2-5H3,(H,33,40)(H,34,39)(H2,35,36,42);2*1-2H3/t23?,24-,26?;;/m0../s1 |
| InChIKey | WSXCQCREKQWMRR-GVAHALHOSA-N |
| XLogP | 4.43 |
| TPSA | 170.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.01 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|