C11H18N2O4 — CID 143544049
N-(1-ethoxy-2-oxopropyl)-1-formylpyrrolidine-2-carboxamide (PubChem CID 143544049) has the molecular formula C11H18N2O4 and a molecular weight of 242.27 g/mol. Its IUPAC name is N-(1-ethoxy-2-oxopropyl)-1-formylpyrrolidine-2-carboxamide.
| Compound Name | N-(1-ethoxy-2-oxopropyl)-1-formylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 143544049 |
| Molecular Formula | C11H18N2O4 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | N-(1-ethoxy-2-oxopropyl)-1-formylpyrrolidine-2-carboxamide |
| SMILES | CCOC(NC(=O)C1CCCN1C=O)C(C)=O |
| InChI | InChI=1S/C11H18N2O4/c1-3-17-11(8(2)15)12-10(16)9-5-4-6-13(9)7-14/h7,9,11H,3-6H2,1-2H3,(H,12,16) |
| InChIKey | FFLODBNFOVTKQW-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|