About ethanamine;ethane;(2S)-1-formylpyrrolidine-2-carboxamide
ethanamine;ethane;(2S)-1-formylpyrrolidine-2-carboxamide (PubChem CID 143879707) has the molecular formula C12H29N3O2
and a molecular weight of 247.38 g/mol. Its IUPAC name is ethanamine;ethane;(2S)-1-formylpyrrolidine-2-carboxamide.
Molecular Properties
| Compound Name | ethanamine;ethane;(2S)-1-formylpyrrolidine-2-carboxamide |
| PubChem CID | 143879707 |
| Molecular Formula | C12H29N3O2 |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.23 |
| IUPAC Name | ethanamine;ethane;(2S)-1-formylpyrrolidine-2-carboxamide |
| SMILES | CC.CC.CCN.NC(=O)[C@@H]1CCCN1C=O |
| InChI | InChI=1S/C6H10N2O2.C2H7N.2C2H6/c7-6(10)5-2-1-3-8(5)4-9;1-2-3;2*1-2/h4-5H,1-3H2,(H2,7,10);2-3H2,1H3;2*1-2H3/t5-;;;/m0.../s1 |
| InChIKey | OPFAHQXFKFFVSO-BHRFRFAJSA-N |
| XLogP | 1.11 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethanamine;ethane;(2S)-1-formylpyrrolidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanamine;ethane;(2S)-1-formylpyrrolidine-2-carboxamide?
The IUPAC name of ethanamine;ethane;(2S)-1-formylpyrrolidine-2-carboxamide (CID 143879707) is ethanamine;ethane;(2S)-1-formylpyrrolidine-2-carboxamide.
What is the SMILES notation for ethanamine;ethane;(2S)-1-formylpyrrolidine-2-carboxamide?
The canonical SMILES for ethanamine;ethane;(2S)-1-formylpyrrolidine-2-carboxamide is CC.CC.CCN.NC(=O)[C@@H]1CCCN1C=O.
What is the InChIKey of ethanamine;ethane;(2S)-1-formylpyrrolidine-2-carboxamide?
The InChIKey is OPFAHQXFKFFVSO-BHRFRFAJSA-N. The full InChI is InChI=1S/C6H10N2O2.C2H7N.2C2H6/c7-6(10)5-2-1-3-8(5)4-9;1-2-3;2*1-2/h4-5H,1-3H2,(H2,7,10);2-3H2,1H3;2*1-2H3/t5-;;;/m0.../s1.
What are the key properties of ethanamine;ethane;(2S)-1-formylpyrrolidine-2-carboxamide?
ethanamine;ethane;(2S)-1-formylpyrrolidine-2-carboxamide has a molecular weight of 247.38 g/mol, XLogP of 1.11, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethanamine;ethane;(2S)-1-formylpyrrolidine-2-carboxamide is sourced from PubChem (CID 143879707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).