C9H13FN2O3 — CID 126680418
N-(3-fluoro-2-oxopropyl)-1-formylpyrrolidine-2-carboxamide (PubChem CID 126680418) has the molecular formula C9H13FN2O3 and a molecular weight of 216.21 g/mol. Its IUPAC name is N-(3-fluoro-2-oxopropyl)-1-formylpyrrolidine-2-carboxamide.
| Compound Name | N-(3-fluoro-2-oxopropyl)-1-formylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 126680418 |
| Molecular Formula | C9H13FN2O3 |
| Molecular Weight | 216.21 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | N-(3-fluoro-2-oxopropyl)-1-formylpyrrolidine-2-carboxamide |
| SMILES | O=CN1CCCC1C(=O)NCC(=O)CF |
| InChI | InChI=1S/C9H13FN2O3/c10-4-7(14)5-11-9(15)8-2-1-3-12(8)6-13/h6,8H,1-5H2,(H,11,15) |
| InChIKey | HVNWZSRAQAJQMG-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.21 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|