C20H28N2O2 — CID 134831076
(2S)-1-formyl-N-(4-pentacyclo[7.3.1.14,12.02,7.06,11]tetradecanyl)pyrrolidine-2-carboxamide (PubChem CID 134831076) has the molecular formula C20H28N2O2 and a molecular weight of 328.46 g/mol. Its IUPAC name is (2S)-1-formyl-N-(4-pentacyclo[7.3.1.14,12.02,7.06,11]tetradecanyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-formyl-N-(4-pentacyclo[7.3.1.14,12.02,7.06,11]tetradecanyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 134831076 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | (2S)-1-formyl-N-(4-pentacyclo[7.3.1.14,12.02,7.06,11]tetradecanyl)pyrrolidine-2-carboxamide |
| SMILES | O=CN1CCC[C@H]1C(=O)NC12CC3C4CC5CC3C(C1)C(C5)C4C2 |
| InChI | InChI=1S/C20H28N2O2/c23-10-22-3-1-2-18(22)19(24)21-20-7-15-12-4-11-5-13(15)17(9-20)14(6-11)16(12)8-20/h10-18H,1-9H2,(H,21,24)/t11?,12?,13?,14?,15?,16?,17?,18-,20?/m0/s1 |
| InChIKey | ACRFFHCQEHDYET-XMXKTOLRSA-N |
| XLogP | 2.18 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|