C21H27ClN2O3S — CID 7405439
(2S)-N-(1-adamantyl)-1-(4-chlorophenyl)sulfonylpyrrolidine-2-carboxamide (PubChem CID 7405439) has the molecular formula C21H27ClN2O3S and a molecular weight of 422.98 g/mol. Its IUPAC name is (2S)-N-(1-adamantyl)-1-(4-chlorophenyl)sulfonylpyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-(1-adamantyl)-1-(4-chlorophenyl)sulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 7405439 |
| Molecular Formula | C21H27ClN2O3S |
| Molecular Weight | 422.98 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | (2S)-N-(1-adamantyl)-1-(4-chlorophenyl)sulfonylpyrrolidine-2-carboxamide |
| SMILES | O=C(NC12CC3CC(CC(C3)C1)C2)[C@@H]1CCCN1S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H27ClN2O3S/c22-17-3-5-18(6-4-17)28(26,27)24-7-1-2-19(24)20(25)23-21-11-14-8-15(12-21)10-16(9-14)13-21/h3-6,14-16,19H,1-2,7-13H2,(H,23,25)/t14?,15?,16?,19-,21?/m0/s1 |
| InChIKey | QXSUPOHWYLZWIN-IXYLRAAXSA-N |
| XLogP | 3.58 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.98 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |