C16H16ClN3O4S2 — CID 2649721
(2R)-N-(3-carbamoylthiophen-2-yl)-1-(4-chlorophenyl)sulfonylpyrrolidine-2-carboxamide (PubChem CID 2649721) has the molecular formula C16H16ClN3O4S2 and a molecular weight of 413.91 g/mol. Its IUPAC name is (2R)-N-(3-carbamoylthiophen-2-yl)-1-(4-chlorophenyl)sulfonylpyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-(3-carbamoylthiophen-2-yl)-1-(4-chlorophenyl)sulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 2649721 |
| Molecular Formula | C16H16ClN3O4S2 |
| Molecular Weight | 413.91 g/mol |
| Exact Mass | 413.03 |
| IUPAC Name | (2R)-N-(3-carbamoylthiophen-2-yl)-1-(4-chlorophenyl)sulfonylpyrrolidine-2-carboxamide |
| SMILES | NC(=O)c1ccsc1NC(=O)[C@H]1CCCN1S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H16ClN3O4S2/c17-10-3-5-11(6-4-10)26(23,24)20-8-1-2-13(20)15(22)19-16-12(14(18)21)7-9-25-16/h3-7,9,13H,1-2,8H2,(H2,18,21)(H,19,22)/t13-/m1/s1 |
| InChIKey | KLRQSQGOLSKWLZ-CYBMUJFWSA-N |
| XLogP | 2.29 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.91 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |