C18H21N3O4S2 — CID 7164097
2-[[4-[(2S)-2-methylpiperidin-1-yl]sulfonylbenzoyl]amino]thiophene-3-carboxamide (PubChem CID 7164097) has the molecular formula C18H21N3O4S2 and a molecular weight of 407.52 g/mol. Its IUPAC name is 2-[[4-[(2S)-2-methylpiperidin-1-yl]sulfonylbenzoyl]amino]thiophene-3-carboxamide.
| Compound Name | 2-[[4-[(2S)-2-methylpiperidin-1-yl]sulfonylbenzoyl]amino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 7164097 |
| Molecular Formula | C18H21N3O4S2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | 2-[[4-[(2S)-2-methylpiperidin-1-yl]sulfonylbenzoyl]amino]thiophene-3-carboxamide |
| SMILES | C[C@H]1CCCCN1S(=O)(=O)c1ccc(C(=O)Nc2sccc2C(N)=O)cc1 |
| InChI | InChI=1S/C18H21N3O4S2/c1-12-4-2-3-10-21(12)27(24,25)14-7-5-13(6-8-14)17(23)20-18-15(16(19)22)9-11-26-18/h5-9,11-12H,2-4,10H2,1H3,(H2,19,22)(H,20,23)/t12-/m0/s1 |
| InChIKey | OQJYHQVPHBSSOA-LBPRGKRZSA-N |
| XLogP | 2.66 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |