C16H17N3O5S2 — CID 5044047
2-[(4-morpholin-4-ylsulfonylbenzoyl)amino]thiophene-3-carboxamide (PubChem CID 5044047) has the molecular formula C16H17N3O5S2 and a molecular weight of 395.46 g/mol. Its IUPAC name is 2-[(4-morpholin-4-ylsulfonylbenzoyl)amino]thiophene-3-carboxamide.
| Compound Name | 2-[(4-morpholin-4-ylsulfonylbenzoyl)amino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 5044047 |
| Molecular Formula | C16H17N3O5S2 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | 2-[(4-morpholin-4-ylsulfonylbenzoyl)amino]thiophene-3-carboxamide |
| SMILES | NC(=O)c1ccsc1NC(=O)c1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C16H17N3O5S2/c17-14(20)13-5-10-25-16(13)18-15(21)11-1-3-12(4-2-11)26(22,23)19-6-8-24-9-7-19/h1-5,10H,6-9H2,(H2,17,20)(H,18,21) |
| InChIKey | YEOKXRHZQBEZSE-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |