C14H16N4O5S — CID 2155671
N-(5-methyl-1,3,4-oxadiazol-2-yl)-4-morpholin-4-ylsulfonylbenzamide (PubChem CID 2155671) has the molecular formula C14H16N4O5S and a molecular weight of 352.37 g/mol. Its IUPAC name is N-(5-methyl-1,3,4-oxadiazol-2-yl)-4-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-(5-methyl-1,3,4-oxadiazol-2-yl)-4-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 2155671 |
| Molecular Formula | C14H16N4O5S |
| Molecular Weight | 352.37 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | N-(5-methyl-1,3,4-oxadiazol-2-yl)-4-morpholin-4-ylsulfonylbenzamide |
| SMILES | Cc1nnc(NC(=O)c2ccc(S(=O)(=O)N3CCOCC3)cc2)o1 |
| InChI | InChI=1S/C14H16N4O5S/c1-10-16-17-14(23-10)15-13(19)11-2-4-12(5-3-11)24(20,21)18-6-8-22-9-7-18/h2-5H,6-9H2,1H3,(H,15,17,19) |
| InChIKey | QKMFLWCSOZDYSU-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 114.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.37 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |