C19H24N4O5S — CID 4646426
N-(5-cyclohexyl-1,3,4-oxadiazol-2-yl)-4-morpholin-4-ylsulfonylbenzamide (PubChem CID 4646426) has the molecular formula C19H24N4O5S and a molecular weight of 420.49 g/mol. Its IUPAC name is N-(5-cyclohexyl-1,3,4-oxadiazol-2-yl)-4-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-(5-cyclohexyl-1,3,4-oxadiazol-2-yl)-4-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 4646426 |
| Molecular Formula | C19H24N4O5S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | N-(5-cyclohexyl-1,3,4-oxadiazol-2-yl)-4-morpholin-4-ylsulfonylbenzamide |
| SMILES | O=C(Nc1nnc(C2CCCCC2)o1)c1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C19H24N4O5S/c24-17(20-19-22-21-18(28-19)15-4-2-1-3-5-15)14-6-8-16(9-7-14)29(25,26)23-10-12-27-13-11-23/h6-9,15H,1-5,10-13H2,(H,20,22,24) |
| InChIKey | DXEFUBGUQPOSCO-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 114.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |