C22H28ClNO3S — CID 58324676
2-(2-adamantyl)-1-[(2R)-1-(4-chlorophenyl)sulfonylpyrrolidin-2-yl]ethanone (PubChem CID 58324676) has the molecular formula C22H28ClNO3S and a molecular weight of 421.99 g/mol. Its IUPAC name is 2-(2-adamantyl)-1-[(2R)-1-(4-chlorophenyl)sulfonylpyrrolidin-2-yl]ethanone.
| Compound Name | 2-(2-adamantyl)-1-[(2R)-1-(4-chlorophenyl)sulfonylpyrrolidin-2-yl]ethanone |
|---|---|
| PubChem CID | 58324676 |
| Molecular Formula | C22H28ClNO3S |
| Molecular Weight | 421.99 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | 2-(2-adamantyl)-1-[(2R)-1-(4-chlorophenyl)sulfonylpyrrolidin-2-yl]ethanone |
| SMILES | O=C(CC1C2CC3CC(C2)CC1C3)[C@H]1CCCN1S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H28ClNO3S/c23-18-3-5-19(6-4-18)28(26,27)24-7-1-2-21(24)22(25)13-20-16-9-14-8-15(11-16)12-17(20)10-14/h3-6,14-17,20-21H,1-2,7-13H2/t14?,15?,16?,17?,20?,21-/m1/s1 |
| InChIKey | VWPZCMSYZIEUOG-OHKFDYCWSA-N |
| XLogP | 4.52 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.99 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |