C14H17ClN2O5S — CID 18291458
(3-amino-3-oxopropyl) (2S)-1-(4-chlorophenyl)sulfonylpyrrolidine-2-carboxylate (PubChem CID 18291458) has the molecular formula C14H17ClN2O5S and a molecular weight of 360.82 g/mol. Its IUPAC name is (3-amino-3-oxopropyl) (2S)-1-(4-chlorophenyl)sulfonylpyrrolidine-2-carboxylate.
| Compound Name | (3-amino-3-oxopropyl) (2S)-1-(4-chlorophenyl)sulfonylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 18291458 |
| Molecular Formula | C14H17ClN2O5S |
| Molecular Weight | 360.82 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | (3-amino-3-oxopropyl) (2S)-1-(4-chlorophenyl)sulfonylpyrrolidine-2-carboxylate |
| SMILES | NC(=O)CCOC(=O)[C@@H]1CCCN1S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H17ClN2O5S/c15-10-3-5-11(6-4-10)23(20,21)17-8-1-2-12(17)14(19)22-9-7-13(16)18/h3-6,12H,1-2,7-9H2,(H2,16,18)/t12-/m0/s1 |
| InChIKey | KIPFOKYDLWWUQS-LBPRGKRZSA-N |
| XLogP | 0.91 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.82 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |