C19H16ClF3N2O5S — CID 4269838
[2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 1-(4-chlorophenyl)sulfonylpyrrolidine-2-carboxylate (PubChem CID 4269838) has the molecular formula C19H16ClF3N2O5S and a molecular weight of 476.86 g/mol. Its IUPAC name is [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 1-(4-chlorophenyl)sulfonylpyrrolidine-2-carboxylate.
| Compound Name | [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 1-(4-chlorophenyl)sulfonylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 4269838 |
| Molecular Formula | C19H16ClF3N2O5S |
| Molecular Weight | 476.86 g/mol |
| Exact Mass | 476.04 |
| IUPAC Name | [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 1-(4-chlorophenyl)sulfonylpyrrolidine-2-carboxylate |
| SMILES | O=C(COC(=O)C1CCCN1S(=O)(=O)c1ccc(Cl)cc1)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C19H16ClF3N2O5S/c20-11-3-5-12(6-4-11)31(28,29)25-9-1-2-15(25)19(27)30-10-16(26)24-14-8-7-13(21)17(22)18(14)23/h3-8,15H,1-2,9-10H2,(H,24,26) |
| InChIKey | AYBYEMRQGSRLRQ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.86 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|