C20H18ClN3O5S — CID 40942099
[2-(4-cyanoanilino)-2-oxoethyl] (2R)-1-(4-chlorophenyl)sulfonylpyrrolidine-2-carboxylate (PubChem CID 40942099) has the molecular formula C20H18ClN3O5S and a molecular weight of 447.90 g/mol. Its IUPAC name is [2-(4-cyanoanilino)-2-oxoethyl] (2R)-1-(4-chlorophenyl)sulfonylpyrrolidine-2-carboxylate.
| Compound Name | [2-(4-cyanoanilino)-2-oxoethyl] (2R)-1-(4-chlorophenyl)sulfonylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 40942099 |
| Molecular Formula | C20H18ClN3O5S |
| Molecular Weight | 447.90 g/mol |
| Exact Mass | 447.07 |
| IUPAC Name | [2-(4-cyanoanilino)-2-oxoethyl] (2R)-1-(4-chlorophenyl)sulfonylpyrrolidine-2-carboxylate |
| SMILES | N#Cc1ccc(NC(=O)COC(=O)[C@H]2CCCN2S(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C20H18ClN3O5S/c21-15-5-9-17(10-6-15)30(27,28)24-11-1-2-18(24)20(26)29-13-19(25)23-16-7-3-14(12-22)4-8-16/h3-10,18H,1-2,11,13H2,(H,23,25)/t18-/m1/s1 |
| InChIKey | FJNCGSYPYUZOET-GOSISDBHSA-N |
| XLogP | 2.55 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.90 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |