C16H26N2O2 — CID 131914978
(2S)-N-(3-hydroxy-1-adamantyl)-1-methylpyrrolidine-2-carboxamide (PubChem CID 131914978) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is (2S)-N-(3-hydroxy-1-adamantyl)-1-methylpyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-(3-hydroxy-1-adamantyl)-1-methylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 131914978 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | (2S)-N-(3-hydroxy-1-adamantyl)-1-methylpyrrolidine-2-carboxamide |
| SMILES | CN1CCC[C@H]1C(=O)NC12CC3CC(CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C16H26N2O2/c1-18-4-2-3-13(18)14(19)17-15-6-11-5-12(7-15)9-16(20,8-11)10-15/h11-13,20H,2-10H2,1H3,(H,17,19)/t11?,12?,13-,15?,16?/m0/s1 |
| InChIKey | ZXTVCINZIJIZCL-JFQZXIRVSA-N |
| XLogP | 1.28 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |