C13H23NO — CID 159589364
(5S,7R)-3-(propan-2-ylamino)adamantan-1-ol (PubChem CID 159589364) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is (5S,7R)-3-(propan-2-ylamino)adamantan-1-ol.
| Compound Name | (5S,7R)-3-(propan-2-ylamino)adamantan-1-ol |
|---|---|
| PubChem CID | 159589364 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | (5S,7R)-3-(propan-2-ylamino)adamantan-1-ol |
| SMILES | CC(C)NC12C[C@@H]3C[C@@H](CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C13H23NO/c1-9(2)14-12-4-10-3-11(5-12)7-13(15,6-10)8-12/h9-11,14-15H,3-8H2,1-2H3/t10-,11+,12?,13? |
| InChIKey | MKARMKJGDQNNAZ-MPEURRAXSA-N |
| XLogP | 2.07 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |