C15H24FNO2 — CID 21063620
2-fluoro-N-(3-hydroxy-1-adamantyl)-2-methylbutanamide (PubChem CID 21063620) has the molecular formula C15H24FNO2 and a molecular weight of 269.36 g/mol. Its IUPAC name is 2-fluoro-N-(3-hydroxy-1-adamantyl)-2-methylbutanamide.
| Compound Name | 2-fluoro-N-(3-hydroxy-1-adamantyl)-2-methylbutanamide |
|---|---|
| PubChem CID | 21063620 |
| Molecular Formula | C15H24FNO2 |
| Molecular Weight | 269.36 g/mol |
| Exact Mass | 269.18 |
| IUPAC Name | 2-fluoro-N-(3-hydroxy-1-adamantyl)-2-methylbutanamide |
| SMILES | CCC(C)(F)C(=O)NC12CC3CC(CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C15H24FNO2/c1-3-13(2,16)12(18)17-14-5-10-4-11(6-14)8-15(19,7-10)9-14/h10-11,19H,3-9H2,1-2H3,(H,17,18) |
| InChIKey | ASJXVXBDFLIRCZ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.36 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |