C17H25F3O3 — CID 59229019
(3-hydroxy-1-adamantyl)methyl 2-methyl-2-(trifluoromethyl)butanoate (PubChem CID 59229019) has the molecular formula C17H25F3O3 and a molecular weight of 334.38 g/mol. Its IUPAC name is (3-hydroxy-1-adamantyl)methyl 2-methyl-2-(trifluoromethyl)butanoate.
| Compound Name | (3-hydroxy-1-adamantyl)methyl 2-methyl-2-(trifluoromethyl)butanoate |
|---|---|
| PubChem CID | 59229019 |
| Molecular Formula | C17H25F3O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | (3-hydroxy-1-adamantyl)methyl 2-methyl-2-(trifluoromethyl)butanoate |
| SMILES | CCC(C)(C(=O)OCC12CC3CC(CC(O)(C3)C1)C2)C(F)(F)F |
| InChI | InChI=1S/C17H25F3O3/c1-3-14(2,17(18,19)20)13(21)23-10-15-5-11-4-12(6-15)8-16(22,7-11)9-15/h11-12,22H,3-10H2,1-2H3 |
| InChIKey | GDNMEHGCVJOBKJ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |