C13H17F2O6S- — CID 102054937
1,1-difluoro-2-[[(5S,7R)-3-hydroxy-1-adamantyl]methoxy]-2-oxoethanesulfonate (PubChem CID 102054937) has the molecular formula C13H17F2O6S- and a molecular weight of 339.34 g/mol. Its IUPAC name is 1,1-difluoro-2-[[(5S,7R)-3-hydroxy-1-adamantyl]methoxy]-2-oxoethanesulfonate.
| Compound Name | 1,1-difluoro-2-[[(5S,7R)-3-hydroxy-1-adamantyl]methoxy]-2-oxoethanesulfonate |
|---|---|
| PubChem CID | 102054937 |
| Molecular Formula | C13H17F2O6S- |
| Molecular Weight | 339.34 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | 1,1-difluoro-2-[[(5S,7R)-3-hydroxy-1-adamantyl]methoxy]-2-oxoethanesulfonate |
| SMILES | O=C(OCC12C[C@@H]3C[C@@H](CC(O)(C3)C1)C2)C(F)(F)S(=O)(=O)[O-] |
| InChI | InChI=1S/C13H18F2O6S/c14-13(15,22(18,19)20)10(16)21-7-11-2-8-1-9(3-11)5-12(17,4-8)6-11/h8-9,17H,1-7H2,(H,18,19,20)/p-1/t8-,9+,11?,12? |
| InChIKey | QGVOWZMNQQHYKQ-LRSDLPTKSA-M |
| XLogP | 1.00 |
| TPSA | 103.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.34 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|