C14H20F2O6S — CID 58696662
1,1-difluoro-2-[[3-(hydroxymethyl)-1-adamantyl]methoxy]-2-oxoethanesulfonic acid (PubChem CID 58696662) has the molecular formula C14H20F2O6S and a molecular weight of 354.37 g/mol. Its IUPAC name is 1,1-difluoro-2-[[3-(hydroxymethyl)-1-adamantyl]methoxy]-2-oxoethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[[3-(hydroxymethyl)-1-adamantyl]methoxy]-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 58696662 |
| Molecular Formula | C14H20F2O6S |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 1,1-difluoro-2-[[3-(hydroxymethyl)-1-adamantyl]methoxy]-2-oxoethanesulfonic acid |
| SMILES | O=C(OCC12CC3CC(CC(CO)(C3)C1)C2)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C14H20F2O6S/c15-14(16,23(19,20)21)11(18)22-8-13-4-9-1-10(5-13)3-12(2-9,6-13)7-17/h9-10,17H,1-8H2,(H,19,20,21) |
| InChIKey | ASSBDDWQVWONAI-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|