C17H29F2NO5S — CID 87359948
2-(1-adamantylmethoxy)-1,1-difluoro-2-oxoethanesulfonic acid;2-methylpropan-2-amine (PubChem CID 87359948) has the molecular formula C17H29F2NO5S and a molecular weight of 397.48 g/mol. Its IUPAC name is 2-(1-adamantylmethoxy)-1,1-difluoro-2-oxoethanesulfonic acid;2-methylpropan-2-amine.
| Compound Name | 2-(1-adamantylmethoxy)-1,1-difluoro-2-oxoethanesulfonic acid;2-methylpropan-2-amine |
|---|---|
| PubChem CID | 87359948 |
| Molecular Formula | C17H29F2NO5S |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | 2-(1-adamantylmethoxy)-1,1-difluoro-2-oxoethanesulfonic acid;2-methylpropan-2-amine |
| SMILES | CC(C)(C)N.O=C(OCC12CC3CC(CC(C3)C1)C2)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C13H18F2O5S.C4H11N/c14-13(15,21(17,18)19)11(16)20-7-12-4-8-1-9(5-12)3-10(2-8)6-12;1-4(2,3)5/h8-10H,1-7H2,(H,17,18,19);5H2,1-3H3 |
| InChIKey | DYTMIULAADLIAX-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|