C14H18F5NO6S2 — CID 122674663
1-adamantylmethyl 2,2-difluoro-2-(trifluoromethylsulfonylsulfamoyl)acetate (PubChem CID 122674663) has the molecular formula C14H18F5NO6S2 and a molecular weight of 455.42 g/mol. Its IUPAC name is 1-adamantylmethyl 2,2-difluoro-2-(trifluoromethylsulfonylsulfamoyl)acetate.
| Compound Name | 1-adamantylmethyl 2,2-difluoro-2-(trifluoromethylsulfonylsulfamoyl)acetate |
|---|---|
| PubChem CID | 122674663 |
| Molecular Formula | C14H18F5NO6S2 |
| Molecular Weight | 455.42 g/mol |
| Exact Mass | 455.05 |
| IUPAC Name | 1-adamantylmethyl 2,2-difluoro-2-(trifluoromethylsulfonylsulfamoyl)acetate |
| SMILES | O=C(OCC12CC3CC(CC(C3)C1)C2)C(F)(F)S(=O)(=O)NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C14H18F5NO6S2/c15-13(16,27(22,23)20-28(24,25)14(17,18)19)11(21)26-7-12-4-8-1-9(5-12)3-10(2-8)6-12/h8-10,20H,1-7H2 |
| InChIKey | CRCAYKAPKILWAQ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.42 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |