C17H20F6O7S — CID 87141747
2-[2-(1-adamantylmethoxy)-2-oxoethoxy]carbonyl-1,1,1,3,3,3-hexafluoropropane-2-sulfonic acid (PubChem CID 87141747) has the molecular formula C17H20F6O7S and a molecular weight of 482.40 g/mol. Its IUPAC name is 2-[2-(1-adamantylmethoxy)-2-oxoethoxy]carbonyl-1,1,1,3,3,3-hexafluoropropane-2-sulfonic acid.
| Compound Name | 2-[2-(1-adamantylmethoxy)-2-oxoethoxy]carbonyl-1,1,1,3,3,3-hexafluoropropane-2-sulfonic acid |
|---|---|
| PubChem CID | 87141747 |
| Molecular Formula | C17H20F6O7S |
| Molecular Weight | 482.40 g/mol |
| Exact Mass | 482.08 |
| IUPAC Name | 2-[2-(1-adamantylmethoxy)-2-oxoethoxy]carbonyl-1,1,1,3,3,3-hexafluoropropane-2-sulfonic acid |
| SMILES | O=C(COC(=O)C(C(F)(F)F)(C(F)(F)F)S(=O)(=O)O)OCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C17H20F6O7S/c18-16(19,20)15(17(21,22)23,31(26,27)28)13(25)29-7-12(24)30-8-14-4-9-1-10(5-14)3-11(2-9)6-14/h9-11H,1-8H2,(H,26,27,28) |
| InChIKey | HLQMVQMKKSUCOO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|