C16H20F6O5S — CID 130402849
2-[[2-(1-adamantyl)acetyl]oxymethyl]-1,1,1,3,3,3-hexafluoropropane-2-sulfonic acid (PubChem CID 130402849) has the molecular formula C16H20F6O5S and a molecular weight of 438.39 g/mol. Its IUPAC name is 2-[[2-(1-adamantyl)acetyl]oxymethyl]-1,1,1,3,3,3-hexafluoropropane-2-sulfonic acid.
| Compound Name | 2-[[2-(1-adamantyl)acetyl]oxymethyl]-1,1,1,3,3,3-hexafluoropropane-2-sulfonic acid |
|---|---|
| PubChem CID | 130402849 |
| Molecular Formula | C16H20F6O5S |
| Molecular Weight | 438.39 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | 2-[[2-(1-adamantyl)acetyl]oxymethyl]-1,1,1,3,3,3-hexafluoropropane-2-sulfonic acid |
| SMILES | O=C(CC12CC3CC(CC(C3)C1)C2)OCC(C(F)(F)F)(C(F)(F)F)S(=O)(=O)O |
| InChI | InChI=1S/C16H20F6O5S/c17-15(18,19)14(16(20,21)22,28(24,25)26)8-27-12(23)7-13-4-9-1-10(5-13)3-11(2-9)6-13/h9-11H,1-8H2,(H,24,25,26) |
| InChIKey | OJCCNWQTDUWCFY-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.39 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|